C19H49N3O7Si3 — CID 143956342
3-[[3-aminopropyl-[3-aminopropyl(diethoxy)silyl]oxy-ethoxysilyl]oxy-diethoxysilyl]propan-1-amine (PubChem CID 143956342) has the molecular formula C19H49N3O7Si3 and a molecular weight of 515.87 g/mol. Its IUPAC name is 3-[[3-aminopropyl-[3-aminopropyl(diethoxy)silyl]oxy-ethoxysilyl]oxy-diethoxysilyl]propan-1-amine.
| Compound Name | 3-[[3-aminopropyl-[3-aminopropyl(diethoxy)silyl]oxy-ethoxysilyl]oxy-diethoxysilyl]propan-1-amine |
|---|---|
| PubChem CID | 143956342 |
| Molecular Formula | C19H49N3O7Si3 |
| Molecular Weight | 515.87 g/mol |
| Exact Mass | 515.29 |
| IUPAC Name | 3-[[3-aminopropyl-[3-aminopropyl(diethoxy)silyl]oxy-ethoxysilyl]oxy-diethoxysilyl]propan-1-amine |
| SMILES | CCO[Si](CCCN)(OCC)O[Si](CCCN)(OCC)O[Si](CCCN)(OCC)OCC |
| InChI | InChI=1S/C19H49N3O7Si3/c1-6-23-30(24-7-2,17-11-14-20)28-32(27-10-5,19-13-16-22)29-31(25-8-3,26-9-4)18-12-15-21/h6-22H2,1-5H3 |
| InChIKey | JTEKJPJLCJKVCG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 142.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.87 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|