C18H44N2O6Si2 — CID 58773749
3-[[(2S)-3-[3-aminopropyl(diethoxy)silyl]oxybutan-2-yl]oxy-diethoxysilyl]propan-1-amine (PubChem CID 58773749) has the molecular formula C18H44N2O6Si2 and a molecular weight of 440.73 g/mol. Its IUPAC name is 3-[[(2S)-3-[3-aminopropyl(diethoxy)silyl]oxybutan-2-yl]oxy-diethoxysilyl]propan-1-amine.
| Compound Name | 3-[[(2S)-3-[3-aminopropyl(diethoxy)silyl]oxybutan-2-yl]oxy-diethoxysilyl]propan-1-amine |
|---|---|
| PubChem CID | 58773749 |
| Molecular Formula | C18H44N2O6Si2 |
| Molecular Weight | 440.73 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | 3-[[(2S)-3-[3-aminopropyl(diethoxy)silyl]oxybutan-2-yl]oxy-diethoxysilyl]propan-1-amine |
| SMILES | CCO[Si](CCCN)(OCC)OC(C)[C@H](C)O[Si](CCCN)(OCC)OCC |
| InChI | InChI=1S/C18H44N2O6Si2/c1-7-21-27(22-8-2,15-11-13-19)25-17(5)18(6)26-28(23-9-3,24-10-4)16-12-14-20/h17-18H,7-16,19-20H2,1-6H3/t17-,18?/m0/s1 |
| InChIKey | HWWFOXGHPDRWID-ZENAZSQFSA-N |
| XLogP | 2.52 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.73 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|