sulfuric acid;3-triethoxysilylpropan-1-amine

C9H25NO7SSi — CID 172732865

IUPACsulfuric acid;3-triethoxysilylpropan-1-amine
SMILESCCO[Si](CCCN)(OCC)OCC.O=S(=O)(O)O
InChIInChI=1S/C9H23NO3Si.H2O4S/c1-4-11-14(12-5-2,13-6-3)9-7-8-10;1-5(2,3)4/h4-10H2,1-3H3;(H2,1,2,3,4)
InChIKeyIALJZJZUOZFFJX-UHFFFAOYSA-N
MW319.45 g/mol
LogP0.73
Rot. Bonds9

About sulfuric acid;3-triethoxysilylpropan-1-amine

sulfuric acid;3-triethoxysilylpropan-1-amine (PubChem CID 172732865) has the molecular formula C9H25NO7SSi and a molecular weight of 319.45 g/mol. Its IUPAC name is sulfuric acid;3-triethoxysilylpropan-1-amine.

Molecular Properties

Compound Namesulfuric acid;3-triethoxysilylpropan-1-amine
PubChem CID172732865
Molecular FormulaC9H25NO7SSi
Molecular Weight319.45 g/mol
Exact Mass319.11
IUPAC Namesulfuric acid;3-triethoxysilylpropan-1-amine
SMILESCCO[Si](CCCN)(OCC)OCC.O=S(=O)(O)O
InChIInChI=1S/C9H23NO3Si.H2O4S/c1-4-11-14(12-5-2,13-6-3)9-7-8-10;1-5(2,3)4/h4-10H2,1-3H3;(H2,1,2,3,4)
InChIKeyIALJZJZUOZFFJX-UHFFFAOYSA-N
XLogP0.73
TPSA128.31 Ų
H-Bond Donors3
H-Bond Acceptors6
Rotatable Bonds9
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500319.45
LogP ≤ 50.73
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze sulfuric acid;3-triethoxysilylpropan-1-amine with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sulfuric acid;3-triethoxysilylpropan-1-amine?
The IUPAC name of sulfuric acid;3-triethoxysilylpropan-1-amine (CID 172732865) is sulfuric acid;3-triethoxysilylpropan-1-amine.
What is the SMILES notation for sulfuric acid;3-triethoxysilylpropan-1-amine?
The canonical SMILES for sulfuric acid;3-triethoxysilylpropan-1-amine is CCO[Si](CCCN)(OCC)OCC.O=S(=O)(O)O.
What is the InChIKey of sulfuric acid;3-triethoxysilylpropan-1-amine?
The InChIKey is IALJZJZUOZFFJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H23NO3Si.H2O4S/c1-4-11-14(12-5-2,13-6-3)9-7-8-10;1-5(2,3)4/h4-10H2,1-3H3;(H2,1,2,3,4).
What are the key properties of sulfuric acid;3-triethoxysilylpropan-1-amine?
sulfuric acid;3-triethoxysilylpropan-1-amine has a molecular weight of 319.45 g/mol, XLogP of 0.73, 9 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sulfuric acid;3-triethoxysilylpropan-1-amine is sourced from PubChem (CID 172732865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).