C9H25NO7SSi — CID 172732865
sulfuric acid;3-triethoxysilylpropan-1-amine (PubChem CID 172732865) has the molecular formula C9H25NO7SSi and a molecular weight of 319.45 g/mol. Its IUPAC name is sulfuric acid;3-triethoxysilylpropan-1-amine.
| Compound Name | sulfuric acid;3-triethoxysilylpropan-1-amine |
|---|---|
| PubChem CID | 172732865 |
| Molecular Formula | C9H25NO7SSi |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | sulfuric acid;3-triethoxysilylpropan-1-amine |
| SMILES | CCO[Si](CCCN)(OCC)OCC.O=S(=O)(O)O |
| InChI | InChI=1S/C9H23NO3Si.H2O4S/c1-4-11-14(12-5-2,13-6-3)9-7-8-10;1-5(2,3)4/h4-10H2,1-3H3;(H2,1,2,3,4) |
| InChIKey | IALJZJZUOZFFJX-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|