C14H39N3O2Si3 — CID 59096415
N'-[3-[[[3-aminopropyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propyl]ethane-1,2-diamine (PubChem CID 59096415) has the molecular formula C14H39N3O2Si3 and a molecular weight of 365.74 g/mol. Its IUPAC name is N'-[3-[[[3-aminopropyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propyl]ethane-1,2-diamine.
| Compound Name | N'-[3-[[[3-aminopropyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 59096415 |
| Molecular Formula | C14H39N3O2Si3 |
| Molecular Weight | 365.74 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | N'-[3-[[[3-aminopropyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propyl]ethane-1,2-diamine |
| SMILES | C[Si](C)(CCCN)O[Si](C)(C)O[Si](C)(C)CCCNCCN |
| InChI | InChI=1S/C14H39N3O2Si3/c1-20(2,13-7-9-15)18-22(5,6)19-21(3,4)14-8-11-17-12-10-16/h17H,7-16H2,1-6H3 |
| InChIKey | ACIWXBOXDKTFCV-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.74 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|