C20H52N2O4Si5 — CID 59904297
CID 59904297 (PubChem CID 59904297) has the molecular formula C20H52N2O4Si5 and a molecular weight of 525.08 g/mol.
| Compound Name | CID 59904297 |
|---|---|
| PubChem CID | 59904297 |
| Molecular Formula | C20H52N2O4Si5 |
| Molecular Weight | 525.08 g/mol |
| Exact Mass | 524.28 |
| IUPAC Name | — |
| SMILES | [CH]CCCC[Si](C)(O[Si](C)(C)C)O[Si](C)(CCCNCCN)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C20H52N2O4Si5/c1-12-13-14-19-30(10,24-28(5,6)7)26-31(11,20-15-17-22-18-16-21)25-29(8,9)23-27(2,3)4/h1,22H,12-21H2,2-11H3 |
| InChIKey | BKEXQXHVICNJDW-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 74.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.08 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|