C11H32N2O4Si3 — CID 167605652
N'-[3-(hydroxy-trimethylsilyloxy-trimethylsilylperoxysilyl)propyl]ethane-1,2-diamine (PubChem CID 167605652) has the molecular formula C11H32N2O4Si3 and a molecular weight of 340.65 g/mol. Its IUPAC name is N'-[3-(hydroxy-trimethylsilyloxy-trimethylsilylperoxysilyl)propyl]ethane-1,2-diamine.
| Compound Name | N'-[3-(hydroxy-trimethylsilyloxy-trimethylsilylperoxysilyl)propyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 167605652 |
| Molecular Formula | C11H32N2O4Si3 |
| Molecular Weight | 340.65 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | N'-[3-(hydroxy-trimethylsilyloxy-trimethylsilylperoxysilyl)propyl]ethane-1,2-diamine |
| SMILES | C[Si](C)(C)OO[Si](O)(CCCNCCN)O[Si](C)(C)C |
| InChI | InChI=1S/C11H32N2O4Si3/c1-18(2,3)15-16-20(14,17-19(4,5)6)11-7-9-13-10-8-12/h13-14H,7-12H2,1-6H3 |
| InChIKey | KIOCCIKSRKDCEF-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.65 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|