C12H38N2O7Si8 — CID 59602812
CID 59602812 (PubChem CID 59602812) has the molecular formula C12H38N2O7Si8 and a molecular weight of 547.13 g/mol.
| Compound Name | CID 59602812 |
|---|---|
| PubChem CID | 59602812 |
| Molecular Formula | C12H38N2O7Si8 |
| Molecular Weight | 547.13 g/mol |
| Exact Mass | 546.08 |
| IUPAC Name | — |
| SMILES | C[Si](C)(C)O[Si](C)(C)O[Si](O[Si]O)([Si]O)[Si](O)([Si]O)[Si](C)(C)CCCNCCN |
| InChI | InChI=1S/C12H38N2O7Si8/c1-25(2,3)20-27(6,7)21-29(24-17,19-22-15)28(18,23-16)26(4,5)12-8-10-14-11-9-13/h14-18H,8-13H2,1-7H3 |
| InChIKey | WIPNHUISZQJLTF-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 146.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.13 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|