C12H32N4O2Si — CID 178166442
N'-[2-[2-(3-aminopropylamino)ethoxy-dimethylsilyl]oxyethyl]propane-1,3-diamine (PubChem CID 178166442) has the molecular formula C12H32N4O2Si and a molecular weight of 292.50 g/mol. Its IUPAC name is N'-[2-[2-(3-aminopropylamino)ethoxy-dimethylsilyl]oxyethyl]propane-1,3-diamine.
| Compound Name | N'-[2-[2-(3-aminopropylamino)ethoxy-dimethylsilyl]oxyethyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 178166442 |
| Molecular Formula | C12H32N4O2Si |
| Molecular Weight | 292.50 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | N'-[2-[2-(3-aminopropylamino)ethoxy-dimethylsilyl]oxyethyl]propane-1,3-diamine |
| SMILES | C[Si](C)(OCCNCCCN)OCCNCCCN |
| InChI | InChI=1S/C12H32N4O2Si/c1-19(2,17-11-9-15-7-3-5-13)18-12-10-16-8-4-6-14/h15-16H,3-14H2,1-2H3 |
| InChIKey | ZVMXPZURPBVQMY-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.50 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|