C12H30N2O3Si — CID 54277347
N'-(6-trimethoxysilylhexyl)propane-1,3-diamine (PubChem CID 54277347) has the molecular formula C12H30N2O3Si and a molecular weight of 278.47 g/mol. Its IUPAC name is N'-(6-trimethoxysilylhexyl)propane-1,3-diamine.
| Compound Name | N'-(6-trimethoxysilylhexyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 54277347 |
| Molecular Formula | C12H30N2O3Si |
| Molecular Weight | 278.47 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | N'-(6-trimethoxysilylhexyl)propane-1,3-diamine |
| SMILES | CO[Si](CCCCCCNCCCN)(OC)OC |
| InChI | InChI=1S/C12H30N2O3Si/c1-15-18(16-2,17-3)12-7-5-4-6-10-14-11-8-9-13/h14H,4-13H2,1-3H3 |
| InChIKey | ROIBBWUTMWFUTG-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.47 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|