C12H31N3O3Si — CID 87376652
N'-[3-(trimethoxysilylamino)propyl]hexane-1,6-diamine (PubChem CID 87376652) has the molecular formula C12H31N3O3Si and a molecular weight of 293.48 g/mol. Its IUPAC name is N'-[3-(trimethoxysilylamino)propyl]hexane-1,6-diamine.
| Compound Name | N'-[3-(trimethoxysilylamino)propyl]hexane-1,6-diamine |
|---|---|
| PubChem CID | 87376652 |
| Molecular Formula | C12H31N3O3Si |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | N'-[3-(trimethoxysilylamino)propyl]hexane-1,6-diamine |
| SMILES | CO[Si](NCCCNCCCCCCN)(OC)OC |
| InChI | InChI=1S/C12H31N3O3Si/c1-16-19(17-2,18-3)15-12-8-11-14-10-7-5-4-6-9-13/h14-15H,4-13H2,1-3H3 |
| InChIKey | DTKVMDSBCQYZSU-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|