C10H22N2O4Si — CID 87568873
[acetyloxy-[3-(2-aminoethylamino)propyl]-methylsilyl] acetate (PubChem CID 87568873) has the molecular formula C10H22N2O4Si and a molecular weight of 262.38 g/mol. Its IUPAC name is [acetyloxy-[3-(2-aminoethylamino)propyl]-methylsilyl] acetate.
| Compound Name | [acetyloxy-[3-(2-aminoethylamino)propyl]-methylsilyl] acetate |
|---|---|
| PubChem CID | 87568873 |
| Molecular Formula | C10H22N2O4Si |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | [acetyloxy-[3-(2-aminoethylamino)propyl]-methylsilyl] acetate |
| SMILES | CC(=O)O[Si](C)(CCCNCCN)OC(C)=O |
| InChI | InChI=1S/C10H22N2O4Si/c1-9(13)15-17(3,16-10(2)14)8-4-6-12-7-5-11/h12H,4-8,11H2,1-3H3 |
| InChIKey | MFYXWDQGJHXVTF-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|