C25H61N3O4Si4 — CID 22957542
6-[[3-(2-aminoethylamino)propyl-methyl-trimethylsilyloxysilyl]oxy-methyl-trimethylsilyloxysilyl]-N,N-dipropylhexanamide (PubChem CID 22957542) has the molecular formula C25H61N3O4Si4 and a molecular weight of 580.12 g/mol. Its IUPAC name is 6-[[3-(2-aminoethylamino)propyl-methyl-trimethylsilyloxysilyl]oxy-methyl-trimethylsilyloxysilyl]-N,N-dipropylhexanamide.
| Compound Name | 6-[[3-(2-aminoethylamino)propyl-methyl-trimethylsilyloxysilyl]oxy-methyl-trimethylsilyloxysilyl]-N,N-dipropylhexanamide |
|---|---|
| PubChem CID | 22957542 |
| Molecular Formula | C25H61N3O4Si4 |
| Molecular Weight | 580.12 g/mol |
| Exact Mass | 579.37 |
| IUPAC Name | 6-[[3-(2-aminoethylamino)propyl-methyl-trimethylsilyloxysilyl]oxy-methyl-trimethylsilyloxysilyl]-N,N-dipropylhexanamide |
| SMILES | CCCN(CCC)C(=O)CCCCC[Si](C)(O[Si](C)(C)C)O[Si](C)(CCCNCCN)O[Si](C)(C)C |
| InChI | InChI=1S/C25H61N3O4Si4/c1-11-21-28(22-12-2)25(29)17-14-13-15-23-35(9,30-33(3,4)5)32-36(10,31-34(6,7)8)24-16-19-27-20-18-26/h27H,11-24,26H2,1-10H3 |
| InChIKey | UKNXUNDHALMHAF-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.12 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|