C14H39NO3Si4 — CID 123147792
3-[methyl-(methyl-propyl-trimethylsilyloxysilyl)oxy-trimethylsilyloxysilyl]propan-1-amine (PubChem CID 123147792) has the molecular formula C14H39NO3Si4 and a molecular weight of 381.81 g/mol. Its IUPAC name is 3-[methyl-(methyl-propyl-trimethylsilyloxysilyl)oxy-trimethylsilyloxysilyl]propan-1-amine.
| Compound Name | 3-[methyl-(methyl-propyl-trimethylsilyloxysilyl)oxy-trimethylsilyloxysilyl]propan-1-amine |
|---|---|
| PubChem CID | 123147792 |
| Molecular Formula | C14H39NO3Si4 |
| Molecular Weight | 381.81 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | 3-[methyl-(methyl-propyl-trimethylsilyloxysilyl)oxy-trimethylsilyloxysilyl]propan-1-amine |
| SMILES | CCC[Si](C)(O[Si](C)(C)C)O[Si](C)(CCCN)O[Si](C)(C)C |
| InChI | InChI=1S/C14H39NO3Si4/c1-10-13-21(8,16-19(2,3)4)18-22(9,14-11-12-15)17-20(5,6)7/h10-15H2,1-9H3 |
| InChIKey | NSDSXHGWGGUWQN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.81 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|