C26H66O4Si5 — CID 90726501
dimethyl-[methyl-(8-methyldecyl)-trimethylsilyloxysilyl]oxy-(methyl-propyl-trimethylsilyloxysilyl)oxysilane;ethane (PubChem CID 90726501) has the molecular formula C26H66O4Si5 and a molecular weight of 583.24 g/mol. Its IUPAC name is dimethyl-[methyl-(8-methyldecyl)-trimethylsilyloxysilyl]oxy-(methyl-propyl-trimethylsilyloxysilyl)oxysilane;ethane.
| Compound Name | dimethyl-[methyl-(8-methyldecyl)-trimethylsilyloxysilyl]oxy-(methyl-propyl-trimethylsilyloxysilyl)oxysilane;ethane |
|---|---|
| PubChem CID | 90726501 |
| Molecular Formula | C26H66O4Si5 |
| Molecular Weight | 583.24 g/mol |
| Exact Mass | 582.38 |
| IUPAC Name | dimethyl-[methyl-(8-methyldecyl)-trimethylsilyloxysilyl]oxy-(methyl-propyl-trimethylsilyloxysilyl)oxysilane;ethane |
| SMILES | CC.CCC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)O[Si](C)(CCCCCCCC(C)CC)O[Si](C)(C)C |
| InChI | InChI=1S/C24H60O4Si5.C2H6/c1-14-22-32(12,25-29(4,5)6)27-31(10,11)28-33(13,26-30(7,8)9)23-20-18-16-17-19-21-24(3)15-2;1-2/h24H,14-23H2,1-13H3;1-2H3 |
| InChIKey | IOOUNXKXARSFOA-UHFFFAOYSA-N |
| XLogP | 10.39 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.24 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|