C12H33NO2Si3 — CID 140893293
3-[propyl-bis(trimethylsilyloxy)silyl]propan-1-amine (PubChem CID 140893293) has the molecular formula C12H33NO2Si3 and a molecular weight of 307.66 g/mol. Its IUPAC name is 3-[propyl-bis(trimethylsilyloxy)silyl]propan-1-amine.
| Compound Name | 3-[propyl-bis(trimethylsilyloxy)silyl]propan-1-amine |
|---|---|
| PubChem CID | 140893293 |
| Molecular Formula | C12H33NO2Si3 |
| Molecular Weight | 307.66 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 3-[propyl-bis(trimethylsilyloxy)silyl]propan-1-amine |
| SMILES | CCC[Si](CCCN)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C12H33NO2Si3/c1-8-11-18(12-9-10-13,14-16(2,3)4)15-17(5,6)7/h8-13H2,1-7H3 |
| InChIKey | WOYBHVAWWQRTAL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.66 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|