About ethyl(trimethyl)silane;3-trimethylsilylpropan-1-amine
ethyl(trimethyl)silane;3-trimethylsilylpropan-1-amine (PubChem CID 90988391) has the molecular formula C11H31NSi2
and a molecular weight of 233.55 g/mol. Its IUPAC name is ethyl(trimethyl)silane;3-trimethylsilylpropan-1-amine.
Molecular Properties
| Compound Name | ethyl(trimethyl)silane;3-trimethylsilylpropan-1-amine |
| PubChem CID | 90988391 |
| Molecular Formula | C11H31NSi2 |
| Molecular Weight | 233.55 g/mol |
| Exact Mass | 233.20 |
| IUPAC Name | ethyl(trimethyl)silane;3-trimethylsilylpropan-1-amine |
| SMILES | CC[Si](C)(C)C.C[Si](C)(C)CCCN |
| InChI | InChI=1S/C6H17NSi.C5H14Si/c1-8(2,3)6-4-5-7;1-5-6(2,3)4/h4-7H2,1-3H3;5H2,1-4H3 |
| InChIKey | PYDSVMMQKTVFCV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.55 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethyl(trimethyl)silane;3-trimethylsilylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl(trimethyl)silane;3-trimethylsilylpropan-1-amine?
The IUPAC name of ethyl(trimethyl)silane;3-trimethylsilylpropan-1-amine (CID 90988391) is ethyl(trimethyl)silane;3-trimethylsilylpropan-1-amine.
What is the SMILES notation for ethyl(trimethyl)silane;3-trimethylsilylpropan-1-amine?
The canonical SMILES for ethyl(trimethyl)silane;3-trimethylsilylpropan-1-amine is CC[Si](C)(C)C.C[Si](C)(C)CCCN.
What is the InChIKey of ethyl(trimethyl)silane;3-trimethylsilylpropan-1-amine?
The InChIKey is PYDSVMMQKTVFCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H17NSi.C5H14Si/c1-8(2,3)6-4-5-7;1-5-6(2,3)4/h4-7H2,1-3H3;5H2,1-4H3.
What are the key properties of ethyl(trimethyl)silane;3-trimethylsilylpropan-1-amine?
ethyl(trimethyl)silane;3-trimethylsilylpropan-1-amine has a molecular weight of 233.55 g/mol, XLogP of 4.02, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl(trimethyl)silane;3-trimethylsilylpropan-1-amine is sourced from PubChem (CID 90988391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).