C28H72N4Si5 — CID 102284214
3-[dimethyl-[2-[tris[2-[3-aminopropyl(dimethyl)silyl]ethyl]silyl]ethyl]silyl]propan-1-amine (PubChem CID 102284214) has the molecular formula C28H72N4Si5 and a molecular weight of 605.34 g/mol. Its IUPAC name is 3-[dimethyl-[2-[tris[2-[3-aminopropyl(dimethyl)silyl]ethyl]silyl]ethyl]silyl]propan-1-amine.
| Compound Name | 3-[dimethyl-[2-[tris[2-[3-aminopropyl(dimethyl)silyl]ethyl]silyl]ethyl]silyl]propan-1-amine |
|---|---|
| PubChem CID | 102284214 |
| Molecular Formula | C28H72N4Si5 |
| Molecular Weight | 605.34 g/mol |
| Exact Mass | 604.46 |
| IUPAC Name | 3-[dimethyl-[2-[tris[2-[3-aminopropyl(dimethyl)silyl]ethyl]silyl]ethyl]silyl]propan-1-amine |
| SMILES | C[Si](C)(CCCN)CC[Si](CC[Si](C)(C)CCCN)(CC[Si](C)(C)CCCN)CC[Si](C)(C)CCCN |
| InChI | InChI=1S/C28H72N4Si5/c1-33(2,17-9-13-29)21-25-37(26-22-34(3,4)18-10-14-30,27-23-35(5,6)19-11-15-31)28-24-36(7,8)20-12-16-32/h9-32H2,1-8H3 |
| InChIKey | ZTELVPFTEGLUIA-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.34 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|