C7H21NO5Si2 — CID 165097689
3-[[butyl(dihydroxy)silyl]oxy-dihydroxysilyl]propan-1-amine (PubChem CID 165097689) has the molecular formula C7H21NO5Si2 and a molecular weight of 255.42 g/mol. Its IUPAC name is 3-[[butyl(dihydroxy)silyl]oxy-dihydroxysilyl]propan-1-amine.
| Compound Name | 3-[[butyl(dihydroxy)silyl]oxy-dihydroxysilyl]propan-1-amine |
|---|---|
| PubChem CID | 165097689 |
| Molecular Formula | C7H21NO5Si2 |
| Molecular Weight | 255.42 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 3-[[butyl(dihydroxy)silyl]oxy-dihydroxysilyl]propan-1-amine |
| SMILES | CCCC[Si](O)(O)O[Si](O)(O)CCCN |
| InChI | InChI=1S/C7H21NO5Si2/c1-2-3-6-14(9,10)13-15(11,12)7-4-5-8/h9-12H,2-8H2,1H3 |
| InChIKey | XUDDMPIVHUTQCB-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.42 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|