C16H41NO3Si4 — CID 158811260
3-[[[[butyl(dimethyl)silyl]oxy-ethynyl-methylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propan-1-amine;molecular hydrogen (PubChem CID 158811260) has the molecular formula C16H41NO3Si4 and a molecular weight of 407.85 g/mol. Its IUPAC name is 3-[[[[butyl(dimethyl)silyl]oxy-ethynyl-methylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propan-1-amine;molecular hydrogen.
| Compound Name | 3-[[[[butyl(dimethyl)silyl]oxy-ethynyl-methylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propan-1-amine;molecular hydrogen |
|---|---|
| PubChem CID | 158811260 |
| Molecular Formula | C16H41NO3Si4 |
| Molecular Weight | 407.85 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 3-[[[[butyl(dimethyl)silyl]oxy-ethynyl-methylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propan-1-amine;molecular hydrogen |
| SMILES | C#C[Si](C)(O[Si](C)(C)CCCC)O[Si](C)(C)O[Si](C)(C)CCCN.[H][H] |
| InChI | InChI=1S/C16H39NO3Si4.H2/c1-10-12-15-22(5,6)19-24(9,11-2)20-23(7,8)18-21(3,4)16-13-14-17;/h2H,10,12-17H2,1,3-9H3;1H |
| InChIKey | IUSINNIBRSPDOO-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.85 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|