C10H27N3O3Si — CID 175223273
1-N-(3-trimethoxysilylpropyl)butane-1,2,3-triamine (PubChem CID 175223273) has the molecular formula C10H27N3O3Si and a molecular weight of 265.43 g/mol. Its IUPAC name is 1-N-(3-trimethoxysilylpropyl)butane-1,2,3-triamine.
| Compound Name | 1-N-(3-trimethoxysilylpropyl)butane-1,2,3-triamine |
|---|---|
| PubChem CID | 175223273 |
| Molecular Formula | C10H27N3O3Si |
| Molecular Weight | 265.43 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 1-N-(3-trimethoxysilylpropyl)butane-1,2,3-triamine |
| SMILES | CO[Si](CCCNCC(N)C(C)N)(OC)OC |
| InChI | InChI=1S/C10H27N3O3Si/c1-9(11)10(12)8-13-6-5-7-17(14-2,15-3)16-4/h9-10,13H,5-8,11-12H2,1-4H3 |
| InChIKey | OTVFETFXJIOYEI-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.43 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|