C18H44N2O7Si2 — CID 20618096
N'-[2-(4-trimethoxysilylbutoxy)propyl]-N-(3-trimethoxysilylpropyl)ethane-1,2-diamine (PubChem CID 20618096) has the molecular formula C18H44N2O7Si2 and a molecular weight of 456.73 g/mol. Its IUPAC name is N'-[2-(4-trimethoxysilylbutoxy)propyl]-N-(3-trimethoxysilylpropyl)ethane-1,2-diamine.
| Compound Name | N'-[2-(4-trimethoxysilylbutoxy)propyl]-N-(3-trimethoxysilylpropyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 20618096 |
| Molecular Formula | C18H44N2O7Si2 |
| Molecular Weight | 456.73 g/mol |
| Exact Mass | 456.27 |
| IUPAC Name | N'-[2-(4-trimethoxysilylbutoxy)propyl]-N-(3-trimethoxysilylpropyl)ethane-1,2-diamine |
| SMILES | CO[Si](CCCCOC(C)CNCCNCCC[Si](OC)(OC)OC)(OC)OC |
| InChI | InChI=1S/C18H44N2O7Si2/c1-18(27-14-8-9-15-28(21-2,22-3)23-4)17-20-13-12-19-11-10-16-29(24-5,25-6)26-7/h18-20H,8-17H2,1-7H3 |
| InChIKey | NZNRBACAVFRTCG-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 88.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.73 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|