C14H32N2O4 — CID 58589932
N,N'-bis[2-(2-methoxyethoxy)propyl]ethane-1,2-diamine (PubChem CID 58589932) has the molecular formula C14H32N2O4 and a molecular weight of 292.42 g/mol. Its IUPAC name is N,N'-bis[2-(2-methoxyethoxy)propyl]ethane-1,2-diamine.
| Compound Name | N,N'-bis[2-(2-methoxyethoxy)propyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 58589932 |
| Molecular Formula | C14H32N2O4 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | N,N'-bis[2-(2-methoxyethoxy)propyl]ethane-1,2-diamine |
| SMILES | COCCOC(C)CNCCNCC(C)OCCOC |
| InChI | InChI=1S/C14H32N2O4/c1-13(19-9-7-17-3)11-15-5-6-16-12-14(2)20-10-8-18-4/h13-16H,5-12H2,1-4H3 |
| InChIKey | WESDFTNSEAGWNU-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 60.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|