C17H41NO6Si2 — CID 87149014
3-[diethoxy(methoxy)silyl]-N-[3-[diethoxy(methoxy)silyl]propyl]-2-methylpropan-1-amine (PubChem CID 87149014) has the molecular formula C17H41NO6Si2 and a molecular weight of 411.69 g/mol. Its IUPAC name is 3-[diethoxy(methoxy)silyl]-N-[3-[diethoxy(methoxy)silyl]propyl]-2-methylpropan-1-amine.
| Compound Name | 3-[diethoxy(methoxy)silyl]-N-[3-[diethoxy(methoxy)silyl]propyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 87149014 |
| Molecular Formula | C17H41NO6Si2 |
| Molecular Weight | 411.69 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | 3-[diethoxy(methoxy)silyl]-N-[3-[diethoxy(methoxy)silyl]propyl]-2-methylpropan-1-amine |
| SMILES | CCO[Si](CCCNCC(C)C[Si](OC)(OCC)OCC)(OC)OCC |
| InChI | InChI=1S/C17H41NO6Si2/c1-8-21-25(19-6,22-9-2)14-12-13-18-15-17(5)16-26(20-7,23-10-3)24-11-4/h17-18H,8-16H2,1-7H3 |
| InChIKey | XBPLKWXGJIFLDS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 67.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.69 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|