C11H28N2O2Si — CID 56649462
N'-[3-[diethoxy(methyl)silyl]-2-methylpropyl]ethane-1,2-diamine (PubChem CID 56649462) has the molecular formula C11H28N2O2Si and a molecular weight of 248.44 g/mol. Its IUPAC name is N'-[3-[diethoxy(methyl)silyl]-2-methylpropyl]ethane-1,2-diamine.
| Compound Name | N'-[3-[diethoxy(methyl)silyl]-2-methylpropyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 56649462 |
| Molecular Formula | C11H28N2O2Si |
| Molecular Weight | 248.44 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | N'-[3-[diethoxy(methyl)silyl]-2-methylpropyl]ethane-1,2-diamine |
| SMILES | CCO[Si](C)(CC(C)CNCCN)OCC |
| InChI | InChI=1S/C11H28N2O2Si/c1-5-14-16(4,15-6-2)10-11(3)9-13-8-7-12/h11,13H,5-10,12H2,1-4H3 |
| InChIKey | PIZXXHNNUABEQZ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.44 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|