C17H42N2O5Si2 — CID 102341543
N'-[3-[diethoxy(triethoxysilylmethyl)silyl]-2-methylpropyl]ethane-1,2-diamine (PubChem CID 102341543) has the molecular formula C17H42N2O5Si2 and a molecular weight of 410.70 g/mol. Its IUPAC name is N'-[3-[diethoxy(triethoxysilylmethyl)silyl]-2-methylpropyl]ethane-1,2-diamine.
| Compound Name | N'-[3-[diethoxy(triethoxysilylmethyl)silyl]-2-methylpropyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 102341543 |
| Molecular Formula | C17H42N2O5Si2 |
| Molecular Weight | 410.70 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | N'-[3-[diethoxy(triethoxysilylmethyl)silyl]-2-methylpropyl]ethane-1,2-diamine |
| SMILES | CCO[Si](CC(C)CNCCN)(C[Si](OCC)(OCC)OCC)OCC |
| InChI | InChI=1S/C17H42N2O5Si2/c1-7-20-25(21-8-2,15-17(6)14-19-13-12-18)16-26(22-9-3,23-10-4)24-11-5/h17,19H,7-16,18H2,1-6H3 |
| InChIKey | AZPILJCPSKBEHF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 84.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.70 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|