About diethoxy-(2-methylpropyl)-(triethoxysilylmethyl)silane;hydroiodide
diethoxy-(2-methylpropyl)-(triethoxysilylmethyl)silane;hydroiodide (PubChem CID 175862990) has the molecular formula C15H37IO5Si2
and a molecular weight of 480.53 g/mol. Its IUPAC name is diethoxy-(2-methylpropyl)-(triethoxysilylmethyl)silane;hydroiodide.
Molecular Properties
| Compound Name | diethoxy-(2-methylpropyl)-(triethoxysilylmethyl)silane;hydroiodide |
| PubChem CID | 175862990 |
| Molecular Formula | C15H37IO5Si2 |
| Molecular Weight | 480.53 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | diethoxy-(2-methylpropyl)-(triethoxysilylmethyl)silane;hydroiodide |
| SMILES | CCO[Si](CC(C)C)(C[Si](OCC)(OCC)OCC)OCC.I |
| InChI | InChI=1S/C15H36O5Si2.HI/c1-8-16-21(17-9-2,13-15(6)7)14-22(18-10-3,19-11-4)20-12-5;/h15H,8-14H2,1-7H3;1H |
| InChIKey | QWOIBTAZUMQBAM-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 480.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze diethoxy-(2-methylpropyl)-(triethoxysilylmethyl)silane;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethoxy-(2-methylpropyl)-(triethoxysilylmethyl)silane;hydroiodide?
The IUPAC name of diethoxy-(2-methylpropyl)-(triethoxysilylmethyl)silane;hydroiodide (CID 175862990) is diethoxy-(2-methylpropyl)-(triethoxysilylmethyl)silane;hydroiodide.
What is the SMILES notation for diethoxy-(2-methylpropyl)-(triethoxysilylmethyl)silane;hydroiodide?
The canonical SMILES for diethoxy-(2-methylpropyl)-(triethoxysilylmethyl)silane;hydroiodide is CCO[Si](CC(C)C)(C[Si](OCC)(OCC)OCC)OCC.I.
What is the InChIKey of diethoxy-(2-methylpropyl)-(triethoxysilylmethyl)silane;hydroiodide?
The InChIKey is QWOIBTAZUMQBAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H36O5Si2.HI/c1-8-16-21(17-9-2,13-15(6)7)14-22(18-10-3,19-11-4)20-12-5;/h15H,8-14H2,1-7H3;1H.
What are the key properties of diethoxy-(2-methylpropyl)-(triethoxysilylmethyl)silane;hydroiodide?
diethoxy-(2-methylpropyl)-(triethoxysilylmethyl)silane;hydroiodide has a molecular weight of 480.53 g/mol, XLogP of 4.36, 14 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethoxy-(2-methylpropyl)-(triethoxysilylmethyl)silane;hydroiodide is sourced from PubChem (CID 175862990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).