About triethoxy(2,2,4-trimethylpentyl)silane
triethoxy(2,2,4-trimethylpentyl)silane (PubChem CID 21480871) has the molecular formula C14H32O3Si
and a molecular weight of 276.49 g/mol. Its IUPAC name is triethoxy(2,2,4-trimethylpentyl)silane.
Molecular Properties
| Compound Name | triethoxy(2,2,4-trimethylpentyl)silane |
| PubChem CID | 21480871 |
| Molecular Formula | C14H32O3Si |
| Molecular Weight | 276.49 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | triethoxy(2,2,4-trimethylpentyl)silane |
| SMILES | CCO[Si](CC(C)(C)CC(C)C)(OCC)OCC |
| InChI | InChI=1S/C14H32O3Si/c1-8-15-18(16-9-2,17-10-3)12-14(6,7)11-13(4)5/h13H,8-12H2,1-7H3 |
| InChIKey | DHEOLHWDNNLCNQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze triethoxy(2,2,4-trimethylpentyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethoxy(2,2,4-trimethylpentyl)silane?
The IUPAC name of triethoxy(2,2,4-trimethylpentyl)silane (CID 21480871) is triethoxy(2,2,4-trimethylpentyl)silane.
What is the SMILES notation for triethoxy(2,2,4-trimethylpentyl)silane?
The canonical SMILES for triethoxy(2,2,4-trimethylpentyl)silane is CCO[Si](CC(C)(C)CC(C)C)(OCC)OCC.
What is the InChIKey of triethoxy(2,2,4-trimethylpentyl)silane?
The InChIKey is DHEOLHWDNNLCNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H32O3Si/c1-8-15-18(16-9-2,17-10-3)12-14(6,7)11-13(4)5/h13H,8-12H2,1-7H3.
What are the key properties of triethoxy(2,2,4-trimethylpentyl)silane?
triethoxy(2,2,4-trimethylpentyl)silane has a molecular weight of 276.49 g/mol, XLogP of 4.11, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for triethoxy(2,2,4-trimethylpentyl)silane is sourced from PubChem (CID 21480871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).