C14H32O3Si — CID 21480871
triethoxy(2,2,4-trimethylpentyl)silane (PubChem CID 21480871) has the molecular formula C14H32O3Si and a molecular weight of 276.49 g/mol. Its IUPAC name is triethoxy(2,2,4-trimethylpentyl)silane.
| Compound Name | triethoxy(2,2,4-trimethylpentyl)silane |
|---|---|
| PubChem CID | 21480871 |
| Molecular Formula | C14H32O3Si |
| Molecular Weight | 276.49 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | triethoxy(2,2,4-trimethylpentyl)silane |
| SMILES | CCO[Si](CC(C)(C)CC(C)C)(OCC)OCC |
| InChI | InChI=1S/C14H32O3Si/c1-8-15-18(16-9-2,17-10-3)12-14(6,7)11-13(4)5/h13H,8-12H2,1-7H3 |
| InChIKey | DHEOLHWDNNLCNQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|