C17H40O3SSi2 — CID 162392217
2,2-dimethylpropyl-diethoxy-(1-triethylsilylsulfanylethoxy)silane (PubChem CID 162392217) has the molecular formula C17H40O3SSi2 and a molecular weight of 380.74 g/mol. Its IUPAC name is 2,2-dimethylpropyl-diethoxy-(1-triethylsilylsulfanylethoxy)silane.
| Compound Name | 2,2-dimethylpropyl-diethoxy-(1-triethylsilylsulfanylethoxy)silane |
|---|---|
| PubChem CID | 162392217 |
| Molecular Formula | C17H40O3SSi2 |
| Molecular Weight | 380.74 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 2,2-dimethylpropyl-diethoxy-(1-triethylsilylsulfanylethoxy)silane |
| SMILES | CCO[Si](CC(C)(C)C)(OCC)OC(C)S[Si](CC)(CC)CC |
| InChI | InChI=1S/C17H40O3SSi2/c1-10-18-23(19-11-2,15-17(7,8)9)20-16(6)21-22(12-3,13-4)14-5/h16H,10-15H2,1-9H3 |
| InChIKey | IMNQNHNASKMWBO-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.74 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|