C12H28O3Si — CID 91365282
3,3-dimethylbutan-2-yl(triethoxy)silane (PubChem CID 91365282) has the molecular formula C12H28O3Si and a molecular weight of 248.44 g/mol. Its IUPAC name is 3,3-dimethylbutan-2-yl(triethoxy)silane.
| Compound Name | 3,3-dimethylbutan-2-yl(triethoxy)silane |
|---|---|
| PubChem CID | 91365282 |
| Molecular Formula | C12H28O3Si |
| Molecular Weight | 248.44 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 3,3-dimethylbutan-2-yl(triethoxy)silane |
| SMILES | CCO[Si](OCC)(OCC)C(C)C(C)(C)C |
| InChI | InChI=1S/C12H28O3Si/c1-8-13-16(14-9-2,15-10-3)11(4)12(5,6)7/h11H,8-10H2,1-7H3 |
| InChIKey | XUBBBUKQNKVIML-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|