About 1-triethoxysilyl-N-trimethylsilylethanamine
1-triethoxysilyl-N-trimethylsilylethanamine (PubChem CID 89350066) has the molecular formula C11H29NO3Si2
and a molecular weight of 279.53 g/mol. Its IUPAC name is 1-triethoxysilyl-N-trimethylsilylethanamine.
Molecular Properties
| Compound Name | 1-triethoxysilyl-N-trimethylsilylethanamine |
| PubChem CID | 89350066 |
| Molecular Formula | C11H29NO3Si2 |
| Molecular Weight | 279.53 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 1-triethoxysilyl-N-trimethylsilylethanamine |
| SMILES | CCO[Si](OCC)(OCC)C(C)N[Si](C)(C)C |
| InChI | InChI=1S/C11H29NO3Si2/c1-8-13-17(14-9-2,15-10-3)11(4)12-16(5,6)7/h11-12H,8-10H2,1-7H3 |
| InChIKey | HIGMWOVSZOPQBL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.53 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-triethoxysilyl-N-trimethylsilylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-triethoxysilyl-N-trimethylsilylethanamine?
The IUPAC name of 1-triethoxysilyl-N-trimethylsilylethanamine (CID 89350066) is 1-triethoxysilyl-N-trimethylsilylethanamine.
What is the SMILES notation for 1-triethoxysilyl-N-trimethylsilylethanamine?
The canonical SMILES for 1-triethoxysilyl-N-trimethylsilylethanamine is CCO[Si](OCC)(OCC)C(C)N[Si](C)(C)C.
What is the InChIKey of 1-triethoxysilyl-N-trimethylsilylethanamine?
The InChIKey is HIGMWOVSZOPQBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H29NO3Si2/c1-8-13-17(14-9-2,15-10-3)11(4)12-16(5,6)7/h11-12H,8-10H2,1-7H3.
What are the key properties of 1-triethoxysilyl-N-trimethylsilylethanamine?
1-triethoxysilyl-N-trimethylsilylethanamine has a molecular weight of 279.53 g/mol, XLogP of 2.39, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-triethoxysilyl-N-trimethylsilylethanamine is sourced from PubChem (CID 89350066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).