C27H64O12Si4 — CID 22222937
triethoxy-[1,3,3-tris(triethoxysilyl)propyl]silane (PubChem CID 22222937) has the molecular formula C27H64O12Si4 and a molecular weight of 693.14 g/mol. Its IUPAC name is triethoxy-[1,3,3-tris(triethoxysilyl)propyl]silane.
| Compound Name | triethoxy-[1,3,3-tris(triethoxysilyl)propyl]silane |
|---|---|
| PubChem CID | 22222937 |
| Molecular Formula | C27H64O12Si4 |
| Molecular Weight | 693.14 g/mol |
| Exact Mass | 692.35 |
| IUPAC Name | triethoxy-[1,3,3-tris(triethoxysilyl)propyl]silane |
| SMILES | CCO[Si](OCC)(OCC)C(CC([Si](OCC)(OCC)OCC)[Si](OCC)(OCC)OCC)[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C27H64O12Si4/c1-13-28-40(29-14-2,30-15-3)26(41(31-16-4,32-17-5)33-18-6)25-27(42(34-19-7,35-20-8)36-21-9)43(37-22-10,38-23-11)39-24-12/h26-27H,13-25H2,1-12H3 |
| InChIKey | KOOBYGHADWYIKP-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 110.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.14 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|