About silane;triethoxy(1-methoxypropyl)silane
silane;triethoxy(1-methoxypropyl)silane (PubChem CID 175591371) has the molecular formula C10H28O4Si2
and a molecular weight of 268.50 g/mol. Its IUPAC name is silane;triethoxy(1-methoxypropyl)silane.
Molecular Properties
| Compound Name | silane;triethoxy(1-methoxypropyl)silane |
| PubChem CID | 175591371 |
| Molecular Formula | C10H28O4Si2 |
| Molecular Weight | 268.50 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | silane;triethoxy(1-methoxypropyl)silane |
| SMILES | CCO[Si](OCC)(OCC)C(CC)OC.[SiH4] |
| InChI | InChI=1S/C10H24O4Si.H4Si/c1-6-10(11-5)15(12-7-2,13-8-3)14-9-4;/h10H,6-9H2,1-5H3;1H4 |
| InChIKey | TUVSUGYUUVHQSW-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.50 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze silane;triethoxy(1-methoxypropyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silane;triethoxy(1-methoxypropyl)silane?
The IUPAC name of silane;triethoxy(1-methoxypropyl)silane (CID 175591371) is silane;triethoxy(1-methoxypropyl)silane.
What is the SMILES notation for silane;triethoxy(1-methoxypropyl)silane?
The canonical SMILES for silane;triethoxy(1-methoxypropyl)silane is CCO[Si](OCC)(OCC)C(CC)OC.[SiH4].
What is the InChIKey of silane;triethoxy(1-methoxypropyl)silane?
The InChIKey is TUVSUGYUUVHQSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24O4Si.H4Si/c1-6-10(11-5)15(12-7-2,13-8-3)14-9-4;/h10H,6-9H2,1-5H3;1H4.
What are the key properties of silane;triethoxy(1-methoxypropyl)silane?
silane;triethoxy(1-methoxypropyl)silane has a molecular weight of 268.50 g/mol, XLogP of 0.55, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for silane;triethoxy(1-methoxypropyl)silane is sourced from PubChem (CID 175591371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).