C21H46O10Si2 — CID 87862101
triethoxy-[1-(oxiran-2-ylmethoxy)propyl]silane;trimethoxy-[1-(oxiran-2-ylmethoxy)propyl]silane (PubChem CID 87862101) has the molecular formula C21H46O10Si2 and a molecular weight of 514.76 g/mol. Its IUPAC name is triethoxy-[1-(oxiran-2-ylmethoxy)propyl]silane;trimethoxy-[1-(oxiran-2-ylmethoxy)propyl]silane.
| Compound Name | triethoxy-[1-(oxiran-2-ylmethoxy)propyl]silane;trimethoxy-[1-(oxiran-2-ylmethoxy)propyl]silane |
|---|---|
| PubChem CID | 87862101 |
| Molecular Formula | C21H46O10Si2 |
| Molecular Weight | 514.76 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | triethoxy-[1-(oxiran-2-ylmethoxy)propyl]silane;trimethoxy-[1-(oxiran-2-ylmethoxy)propyl]silane |
| SMILES | CCC(OCC1CO1)[Si](OC)(OC)OC.CCO[Si](OCC)(OCC)C(CC)OCC1CO1 |
| InChI | InChI=1S/C12H26O5Si.C9H20O5Si/c1-5-12(14-10-11-9-13-11)18(15-6-2,16-7-3)17-8-4;1-5-9(14-7-8-6-13-8)15(10-2,11-3)12-4/h11-12H,5-10H2,1-4H3;8-9H,5-7H2,1-4H3 |
| InChIKey | DJEIZZGRNKIYPF-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 98.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.76 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|