C11H26O4Si2 — CID 175014951
diethoxy-methyl-[(1S)-1-(oxiran-2-ylmethoxy)-1-silylpropan-2-yl]silane (PubChem CID 175014951) has the molecular formula C11H26O4Si2 and a molecular weight of 278.50 g/mol. Its IUPAC name is diethoxy-methyl-[(1S)-1-(oxiran-2-ylmethoxy)-1-silylpropan-2-yl]silane.
| Compound Name | diethoxy-methyl-[(1S)-1-(oxiran-2-ylmethoxy)-1-silylpropan-2-yl]silane |
|---|---|
| PubChem CID | 175014951 |
| Molecular Formula | C11H26O4Si2 |
| Molecular Weight | 278.50 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | diethoxy-methyl-[(1S)-1-(oxiran-2-ylmethoxy)-1-silylpropan-2-yl]silane |
| SMILES | CCO[Si](C)(OCC)C(C)[C@H]([SiH3])OCC1CO1 |
| InChI | InChI=1S/C11H26O4Si2/c1-5-14-17(4,15-6-2)9(3)11(16)13-8-10-7-12-10/h9-11H,5-8H2,1-4,16H3/t9?,10?,11-/m0/s1 |
| InChIKey | HHUOTJCUYWZECH-ILDUYXDCSA-N |
| XLogP | 0.63 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.50 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|