About ethoxysilane;triethoxy-[2-(oxiran-2-ylmethoxy)propyl]silane
ethoxysilane;triethoxy-[2-(oxiran-2-ylmethoxy)propyl]silane (PubChem CID 160854237) has the molecular formula C14H34O6Si2
and a molecular weight of 354.59 g/mol. Its IUPAC name is ethoxysilane;triethoxy-[2-(oxiran-2-ylmethoxy)propyl]silane.
Molecular Properties
| Compound Name | ethoxysilane;triethoxy-[2-(oxiran-2-ylmethoxy)propyl]silane |
| PubChem CID | 160854237 |
| Molecular Formula | C14H34O6Si2 |
| Molecular Weight | 354.59 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | ethoxysilane;triethoxy-[2-(oxiran-2-ylmethoxy)propyl]silane |
| SMILES | CCO[SiH3].CCO[Si](CC(C)OCC1CO1)(OCC)OCC |
| InChI | InChI=1S/C12H26O5Si.C2H8OSi/c1-5-15-18(16-6-2,17-7-3)10-11(4)13-8-12-9-14-12;1-2-3-4/h11-12H,5-10H2,1-4H3;2H2,1,4H3 |
| InChIKey | SJQUPPRDSSUJIT-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.59 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze ethoxysilane;triethoxy-[2-(oxiran-2-ylmethoxy)propyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxysilane;triethoxy-[2-(oxiran-2-ylmethoxy)propyl]silane?
The IUPAC name of ethoxysilane;triethoxy-[2-(oxiran-2-ylmethoxy)propyl]silane (CID 160854237) is ethoxysilane;triethoxy-[2-(oxiran-2-ylmethoxy)propyl]silane.
What is the SMILES notation for ethoxysilane;triethoxy-[2-(oxiran-2-ylmethoxy)propyl]silane?
The canonical SMILES for ethoxysilane;triethoxy-[2-(oxiran-2-ylmethoxy)propyl]silane is CCO[SiH3].CCO[Si](CC(C)OCC1CO1)(OCC)OCC.
What is the InChIKey of ethoxysilane;triethoxy-[2-(oxiran-2-ylmethoxy)propyl]silane?
The InChIKey is SJQUPPRDSSUJIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O5Si.C2H8OSi/c1-5-15-18(16-6-2,17-7-3)10-11(4)13-8-12-9-14-12;1-2-3-4/h11-12H,5-10H2,1-4H3;2H2,1,4H3.
What are the key properties of ethoxysilane;triethoxy-[2-(oxiran-2-ylmethoxy)propyl]silane?
ethoxysilane;triethoxy-[2-(oxiran-2-ylmethoxy)propyl]silane has a molecular weight of 354.59 g/mol, XLogP of 1.14, 12 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxysilane;triethoxy-[2-(oxiran-2-ylmethoxy)propyl]silane is sourced from PubChem (CID 160854237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).