About ethoxysilane;N'-(1-triethoxysilylpropan-2-yl)methanediamine
ethoxysilane;N'-(1-triethoxysilylpropan-2-yl)methanediamine (PubChem CID 159811606) has the molecular formula C12H34N2O4Si2
and a molecular weight of 326.59 g/mol. Its IUPAC name is ethoxysilane;N'-(1-triethoxysilylpropan-2-yl)methanediamine.
Molecular Properties
| Compound Name | ethoxysilane;N'-(1-triethoxysilylpropan-2-yl)methanediamine |
| PubChem CID | 159811606 |
| Molecular Formula | C12H34N2O4Si2 |
| Molecular Weight | 326.59 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | ethoxysilane;N'-(1-triethoxysilylpropan-2-yl)methanediamine |
| SMILES | CCO[SiH3].CCO[Si](CC(C)NCN)(OCC)OCC |
| InChI | InChI=1S/C10H26N2O3Si.C2H8OSi/c1-5-13-16(14-6-2,15-7-3)8-10(4)12-9-11;1-2-3-4/h10,12H,5-9,11H2,1-4H3;2H2,1,4H3 |
| InChIKey | NLCCRQORIHFNIK-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 74.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.59 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethoxysilane;N'-(1-triethoxysilylpropan-2-yl)methanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxysilane;N'-(1-triethoxysilylpropan-2-yl)methanediamine?
The IUPAC name of ethoxysilane;N'-(1-triethoxysilylpropan-2-yl)methanediamine (CID 159811606) is ethoxysilane;N'-(1-triethoxysilylpropan-2-yl)methanediamine.
What is the SMILES notation for ethoxysilane;N'-(1-triethoxysilylpropan-2-yl)methanediamine?
The canonical SMILES for ethoxysilane;N'-(1-triethoxysilylpropan-2-yl)methanediamine is CCO[SiH3].CCO[Si](CC(C)NCN)(OCC)OCC.
What is the InChIKey of ethoxysilane;N'-(1-triethoxysilylpropan-2-yl)methanediamine?
The InChIKey is NLCCRQORIHFNIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H26N2O3Si.C2H8OSi/c1-5-13-16(14-6-2,15-7-3)8-10(4)12-9-11;1-2-3-4/h10,12H,5-9,11H2,1-4H3;2H2,1,4H3.
What are the key properties of ethoxysilane;N'-(1-triethoxysilylpropan-2-yl)methanediamine?
ethoxysilane;N'-(1-triethoxysilylpropan-2-yl)methanediamine has a molecular weight of 326.59 g/mol, XLogP of 0.23, 11 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxysilane;N'-(1-triethoxysilylpropan-2-yl)methanediamine is sourced from PubChem (CID 159811606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).