C14H30Cl2O3Si — CID 91420779
(3,4-dichloro-2,5-dimethylhexyl)-triethoxysilane (PubChem CID 91420779) has the molecular formula C14H30Cl2O3Si and a molecular weight of 345.38 g/mol. Its IUPAC name is (3,4-dichloro-2,5-dimethylhexyl)-triethoxysilane.
| Compound Name | (3,4-dichloro-2,5-dimethylhexyl)-triethoxysilane |
|---|---|
| PubChem CID | 91420779 |
| Molecular Formula | C14H30Cl2O3Si |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (3,4-dichloro-2,5-dimethylhexyl)-triethoxysilane |
| SMILES | CCO[Si](CC(C)C(Cl)C(Cl)C(C)C)(OCC)OCC |
| InChI | InChI=1S/C14H30Cl2O3Si/c1-7-17-20(18-8-2,19-9-3)10-12(6)14(16)13(15)11(4)5/h11-14H,7-10H2,1-6H3 |
| InChIKey | VTSYXHSMFGKUTK-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|