C16H23F5O3Si — CID 90171139
triethoxy-[2-methyl-3-(2,3,4,5,6-pentafluorophenyl)propyl]silane (PubChem CID 90171139) has the molecular formula C16H23F5O3Si and a molecular weight of 386.43 g/mol. Its IUPAC name is triethoxy-[2-methyl-3-(2,3,4,5,6-pentafluorophenyl)propyl]silane.
| Compound Name | triethoxy-[2-methyl-3-(2,3,4,5,6-pentafluorophenyl)propyl]silane |
|---|---|
| PubChem CID | 90171139 |
| Molecular Formula | C16H23F5O3Si |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | triethoxy-[2-methyl-3-(2,3,4,5,6-pentafluorophenyl)propyl]silane |
| SMILES | CCO[Si](CC(C)Cc1c(F)c(F)c(F)c(F)c1F)(OCC)OCC |
| InChI | InChI=1S/C16H23F5O3Si/c1-5-22-25(23-6-2,24-7-3)9-10(4)8-11-12(17)14(19)16(21)15(20)13(11)18/h10H,5-9H2,1-4H3 |
| InChIKey | RFEOIRQASKNSHT-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|