C12H30N2O3Si — CID 154308383
N'-[1-[diethoxy(2-methylpropyl)silyl]oxyethyl]ethane-1,2-diamine (PubChem CID 154308383) has the molecular formula C12H30N2O3Si and a molecular weight of 278.47 g/mol. Its IUPAC name is N'-[1-[diethoxy(2-methylpropyl)silyl]oxyethyl]ethane-1,2-diamine.
| Compound Name | N'-[1-[diethoxy(2-methylpropyl)silyl]oxyethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 154308383 |
| Molecular Formula | C12H30N2O3Si |
| Molecular Weight | 278.47 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | N'-[1-[diethoxy(2-methylpropyl)silyl]oxyethyl]ethane-1,2-diamine |
| SMILES | CCO[Si](CC(C)C)(OCC)OC(C)NCCN |
| InChI | InChI=1S/C12H30N2O3Si/c1-6-15-18(16-7-2,10-11(3)4)17-12(5)14-9-8-13/h11-12,14H,6-10,13H2,1-5H3 |
| InChIKey | CLELYJGPROQYTN-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.47 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|