C20H43O9Si2 — CID 18963637
CID 18963637 (PubChem CID 18963637) has the molecular formula C20H43O9Si2 and a molecular weight of 483.73 g/mol.
| Compound Name | CID 18963637 |
|---|---|
| PubChem CID | 18963637 |
| Molecular Formula | C20H43O9Si2 |
| Molecular Weight | 483.73 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | — |
| SMILES | CCC(OCC1CO1)[Si](OC)(OC)OC.CCO[Si](CC(CC)OCC1CO1)OCC |
| InChI | InChI=1S/C11H23O4Si.C9H20O5Si/c1-4-10(12-7-11-8-13-11)9-16(14-5-2)15-6-3;1-5-9(14-7-8-6-13-8)15(10-2,11-3)12-4/h10-11H,4-9H2,1-3H3;8-9H,5-7H2,1-4H3 |
| InChIKey | YWCRUDCXYSAMES-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 89.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.73 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|