About 1-triethoxysilylpropyl thiohypochlorite
1-triethoxysilylpropyl thiohypochlorite (PubChem CID 175012038) has the molecular formula C9H21ClO3SSi
and a molecular weight of 272.87 g/mol. Its IUPAC name is 1-triethoxysilylpropyl thiohypochlorite.
Molecular Properties
| Compound Name | 1-triethoxysilylpropyl thiohypochlorite |
| PubChem CID | 175012038 |
| Molecular Formula | C9H21ClO3SSi |
| Molecular Weight | 272.87 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 1-triethoxysilylpropyl thiohypochlorite |
| SMILES | CCO[Si](OCC)(OCC)C(CC)SCl |
| InChI | InChI=1S/C9H21ClO3SSi/c1-5-9(14-10)15(11-6-2,12-7-3)13-8-4/h9H,5-8H2,1-4H3 |
| InChIKey | QOGMFOPXYCBKEP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.87 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-triethoxysilylpropyl thiohypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-triethoxysilylpropyl thiohypochlorite?
The IUPAC name of 1-triethoxysilylpropyl thiohypochlorite (CID 175012038) is 1-triethoxysilylpropyl thiohypochlorite.
What is the SMILES notation for 1-triethoxysilylpropyl thiohypochlorite?
The canonical SMILES for 1-triethoxysilylpropyl thiohypochlorite is CCO[Si](OCC)(OCC)C(CC)SCl.
What is the InChIKey of 1-triethoxysilylpropyl thiohypochlorite?
The InChIKey is QOGMFOPXYCBKEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21ClO3SSi/c1-5-9(14-10)15(11-6-2,12-7-3)13-8-4/h9H,5-8H2,1-4H3.
What are the key properties of 1-triethoxysilylpropyl thiohypochlorite?
1-triethoxysilylpropyl thiohypochlorite has a molecular weight of 272.87 g/mol, XLogP of 3.24, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-triethoxysilylpropyl thiohypochlorite is sourced from PubChem (CID 175012038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).