C30H70O12S4Si4 — CID 102409474
[1-[1,2-bis(triethoxysilyl)propyltetrasulfanyl]-1-triethoxysilylpropan-2-yl]-triethoxysilane (PubChem CID 102409474) has the molecular formula C30H70O12S4Si4 and a molecular weight of 863.49 g/mol. Its IUPAC name is [1-[1,2-bis(triethoxysilyl)propyltetrasulfanyl]-1-triethoxysilylpropan-2-yl]-triethoxysilane.
| Compound Name | [1-[1,2-bis(triethoxysilyl)propyltetrasulfanyl]-1-triethoxysilylpropan-2-yl]-triethoxysilane |
|---|---|
| PubChem CID | 102409474 |
| Molecular Formula | C30H70O12S4Si4 |
| Molecular Weight | 863.49 g/mol |
| Exact Mass | 862.28 |
| IUPAC Name | [1-[1,2-bis(triethoxysilyl)propyltetrasulfanyl]-1-triethoxysilylpropan-2-yl]-triethoxysilane |
| SMILES | CCO[Si](OCC)(OCC)C(C)C(SSSSC(C(C)[Si](OCC)(OCC)OCC)[Si](OCC)(OCC)OCC)[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C30H70O12S4Si4/c1-15-31-47(32-16-2,33-17-3)27(13)29(49(37-21-7,38-22-8)39-23-9)43-45-46-44-30(50(40-24-10,41-25-11)42-26-12)28(14)48(34-18-4,35-19-5)36-20-6/h27-30H,15-26H2,1-14H3 |
| InChIKey | YURSOPYOJSZDFU-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 110.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.49 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|