C30H70O12S4Si4 — CID 23283769
[3-[3,3-bis(triethoxysilyl)propyltetrasulfanyl]-1-triethoxysilylpropyl]-triethoxysilane (PubChem CID 23283769) has the molecular formula C30H70O12S4Si4 and a molecular weight of 863.49 g/mol. Its IUPAC name is [3-[3,3-bis(triethoxysilyl)propyltetrasulfanyl]-1-triethoxysilylpropyl]-triethoxysilane.
| Compound Name | [3-[3,3-bis(triethoxysilyl)propyltetrasulfanyl]-1-triethoxysilylpropyl]-triethoxysilane |
|---|---|
| PubChem CID | 23283769 |
| Molecular Formula | C30H70O12S4Si4 |
| Molecular Weight | 863.49 g/mol |
| Exact Mass | 862.28 |
| IUPAC Name | [3-[3,3-bis(triethoxysilyl)propyltetrasulfanyl]-1-triethoxysilylpropyl]-triethoxysilane |
| SMILES | CCO[Si](OCC)(OCC)C(CCSSSSCCC([Si](OCC)(OCC)OCC)[Si](OCC)(OCC)OCC)[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C30H70O12S4Si4/c1-13-31-47(32-14-2,33-15-3)29(48(34-16-4,35-17-5)36-18-6)25-27-43-45-46-44-28-26-30(49(37-19-7,38-20-8)39-21-9)50(40-22-10,41-23-11)42-24-12/h29-30H,13-28H2,1-12H3 |
| InChIKey | IVLBGFRTARNACQ-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 110.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.49 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|