C38H78O6S11Si2 — CID 87752976
triethoxy-[1-(propyltetrasulfanyl)-2-[4-[2-[2-[4-[2-(propyltetrasulfanyl)-2-triethoxysilylethyl]cyclohexyl]ethyltrisulfanyl]ethyl]cyclohexyl]ethyl]silane (PubChem CID 87752976) has the molecular formula C38H78O6S11Si2 and a molecular weight of 1039.94 g/mol. Its IUPAC name is triethoxy-[1-(propyltetrasulfanyl)-2-[4-[2-[2-[4-[2-(propyltetrasulfanyl)-2-triethoxysilylethyl]cyclohexyl]ethyltrisulfanyl]ethyl]cyclohexyl]ethyl]silane.
| Compound Name | triethoxy-[1-(propyltetrasulfanyl)-2-[4-[2-[2-[4-[2-(propyltetrasulfanyl)-2-triethoxysilylethyl]cyclohexyl]ethyltrisulfanyl]ethyl]cyclohexyl]ethyl]silane |
|---|---|
| PubChem CID | 87752976 |
| Molecular Formula | C38H78O6S11Si2 |
| Molecular Weight | 1039.94 g/mol |
| Exact Mass | 1038.23 |
| IUPAC Name | triethoxy-[1-(propyltetrasulfanyl)-2-[4-[2-[2-[4-[2-(propyltetrasulfanyl)-2-triethoxysilylethyl]cyclohexyl]ethyltrisulfanyl]ethyl]cyclohexyl]ethyl]silane |
| SMILES | CCCSSSSC(CC1CCC(CCSSSCCC2CCC(CC(SSSSCCC)[Si](OCC)(OCC)OCC)CC2)CC1)[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C38H78O6S11Si2/c1-9-27-45-52-54-49-37(56(39-11-3,40-12-4)41-13-5)31-35-21-17-33(18-22-35)25-29-47-51-48-30-26-34-19-23-36(24-20-34)32-38(50-55-53-46-28-10-2)57(42-14-6,43-15-7)44-16-8/h33-38H,9-32H2,1-8H3 |
| InChIKey | DJQJAVWBKRHSPP-UHFFFAOYSA-N |
| XLogP | 16.28 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1039.94 |
| LogP ≤ 5 | 16.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|