C36H78O9S10Si3 — CID 87112047
triethoxy-[3-[2-[4-(2-triethoxysilylethyl)-2-[2-(3-triethoxysilylpropylpentasulfanyl)ethyl]cyclohexyl]ethylpentasulfanyl]propyl]silane (PubChem CID 87112047) has the molecular formula C36H78O9S10Si3 and a molecular weight of 1059.94 g/mol. Its IUPAC name is triethoxy-[3-[2-[4-(2-triethoxysilylethyl)-2-[2-(3-triethoxysilylpropylpentasulfanyl)ethyl]cyclohexyl]ethylpentasulfanyl]propyl]silane.
| Compound Name | triethoxy-[3-[2-[4-(2-triethoxysilylethyl)-2-[2-(3-triethoxysilylpropylpentasulfanyl)ethyl]cyclohexyl]ethylpentasulfanyl]propyl]silane |
|---|---|
| PubChem CID | 87112047 |
| Molecular Formula | C36H78O9S10Si3 |
| Molecular Weight | 1059.94 g/mol |
| Exact Mass | 1058.22 |
| IUPAC Name | triethoxy-[3-[2-[4-(2-triethoxysilylethyl)-2-[2-(3-triethoxysilylpropylpentasulfanyl)ethyl]cyclohexyl]ethylpentasulfanyl]propyl]silane |
| SMILES | CCO[Si](CCCSSSSSCCC1CCC(CC[Si](OCC)(OCC)OCC)CC1CCSSSSSCCC[Si](OCC)(OCC)OCC)(OCC)OCC |
| InChI | InChI=1S/C36H78O9S10Si3/c1-10-37-56(38-11-2,39-12-3)30-19-26-46-50-54-52-48-28-23-35-22-21-34(25-32-58(43-16-7,44-17-8)45-18-9)33-36(35)24-29-49-53-55-51-47-27-20-31-57(40-13-4,41-14-5)42-15-6/h34-36H,10-33H2,1-9H3 |
| InChIKey | TZVNMTLJRLYUOP-UHFFFAOYSA-N |
| XLogP | 14.77 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1059.94 |
| LogP ≤ 5 | 14.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|