C36H78O9S8Si3 — CID 87139884
triethoxy-[3-[2-[1-(2-triethoxysilylethyl)-2-[2-(3-triethoxysilylpropyltetrasulfanyl)ethyl]cyclohexyl]ethyltetrasulfanyl]propyl]silane (PubChem CID 87139884) has the molecular formula C36H78O9S8Si3 and a molecular weight of 995.80 g/mol. Its IUPAC name is triethoxy-[3-[2-[1-(2-triethoxysilylethyl)-2-[2-(3-triethoxysilylpropyltetrasulfanyl)ethyl]cyclohexyl]ethyltetrasulfanyl]propyl]silane.
| Compound Name | triethoxy-[3-[2-[1-(2-triethoxysilylethyl)-2-[2-(3-triethoxysilylpropyltetrasulfanyl)ethyl]cyclohexyl]ethyltetrasulfanyl]propyl]silane |
|---|---|
| PubChem CID | 87139884 |
| Molecular Formula | C36H78O9S8Si3 |
| Molecular Weight | 995.80 g/mol |
| Exact Mass | 994.27 |
| IUPAC Name | triethoxy-[3-[2-[1-(2-triethoxysilylethyl)-2-[2-(3-triethoxysilylpropyltetrasulfanyl)ethyl]cyclohexyl]ethyltetrasulfanyl]propyl]silane |
| SMILES | CCO[Si](CCCSSSSCCC1CCCCC1(CCSSSSCCC[Si](OCC)(OCC)OCC)CC[Si](OCC)(OCC)OCC)(OCC)OCC |
| InChI | InChI=1S/C36H78O9S8Si3/c1-10-37-54(38-11-2,39-12-3)32-21-28-46-50-52-48-30-24-35-23-19-20-25-36(35,27-34-56(43-16-7,44-17-8)45-18-9)26-31-49-53-51-47-29-22-33-55(40-13-4,41-14-5)42-15-6/h35H,10-34H2,1-9H3 |
| InChIKey | CQHZAIHKRGEJBW-UHFFFAOYSA-N |
| XLogP | 13.61 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 995.80 |
| LogP ≤ 5 | 13.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|