C21H52O9S5Si3 — CID 174845742
triethoxy-[3-(3-triethoxysilylpropyltetrasulfanyl)propyl]silane;trimethoxy(sulfanyl)silane (PubChem CID 174845742) has the molecular formula C21H52O9S5Si3 and a molecular weight of 693.23 g/mol. Its IUPAC name is triethoxy-[3-(3-triethoxysilylpropyltetrasulfanyl)propyl]silane;trimethoxy(sulfanyl)silane.
| Compound Name | triethoxy-[3-(3-triethoxysilylpropyltetrasulfanyl)propyl]silane;trimethoxy(sulfanyl)silane |
|---|---|
| PubChem CID | 174845742 |
| Molecular Formula | C21H52O9S5Si3 |
| Molecular Weight | 693.23 g/mol |
| Exact Mass | 692.15 |
| IUPAC Name | triethoxy-[3-(3-triethoxysilylpropyltetrasulfanyl)propyl]silane;trimethoxy(sulfanyl)silane |
| SMILES | CCO[Si](CCCSSSSCCC[Si](OCC)(OCC)OCC)(OCC)OCC.CO[Si](S)(OC)OC |
| InChI | InChI=1S/C18H42O6S4Si2.C3H10O3SSi/c1-7-19-29(20-8-2,21-9-3)17-13-15-25-27-28-26-16-14-18-30(22-10-4,23-11-5)24-12-6;1-4-8(7,5-2)6-3/h7-18H2,1-6H3;7H,1-3H3 |
| InChIKey | RNZFGCYVATWNCF-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 83.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.23 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|