C24H56N2O6S4Si2 — CID 87342465
3-[3-[3-[3-(dimethylamino)propoxy-diethoxysilyl]propyltetrasulfanyl]propyl-diethoxysilyl]oxy-N,N-dimethylpropan-1-amine (PubChem CID 87342465) has the molecular formula C24H56N2O6S4Si2 and a molecular weight of 653.16 g/mol. Its IUPAC name is 3-[3-[3-[3-(dimethylamino)propoxy-diethoxysilyl]propyltetrasulfanyl]propyl-diethoxysilyl]oxy-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[3-[3-[3-(dimethylamino)propoxy-diethoxysilyl]propyltetrasulfanyl]propyl-diethoxysilyl]oxy-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 87342465 |
| Molecular Formula | C24H56N2O6S4Si2 |
| Molecular Weight | 653.16 g/mol |
| Exact Mass | 652.26 |
| IUPAC Name | 3-[3-[3-[3-(dimethylamino)propoxy-diethoxysilyl]propyltetrasulfanyl]propyl-diethoxysilyl]oxy-N,N-dimethylpropan-1-amine |
| SMILES | CCO[Si](CCCSSSSCCC[Si](OCC)(OCC)OCCCN(C)C)(OCC)OCCCN(C)C |
| InChI | InChI=1S/C24H56N2O6S4Si2/c1-9-27-37(28-10-2,31-19-13-17-25(5)6)23-15-21-33-35-36-34-22-16-24-38(29-11-3,30-12-4)32-20-14-18-26(7)8/h9-24H2,1-8H3 |
| InChIKey | XSWJUZHFYMFXPD-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 61.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.16 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|