C35H69NO3Si — CID 164755016
N,N-dimethyl-3-tris[(Z)-dec-4-enoxy]silylpropan-1-amine (PubChem CID 164755016) has the molecular formula C35H69NO3Si and a molecular weight of 580.03 g/mol. Its IUPAC name is N,N-dimethyl-3-tris[(Z)-dec-4-enoxy]silylpropan-1-amine.
| Compound Name | N,N-dimethyl-3-tris[(Z)-dec-4-enoxy]silylpropan-1-amine |
|---|---|
| PubChem CID | 164755016 |
| Molecular Formula | C35H69NO3Si |
| Molecular Weight | 580.03 g/mol |
| Exact Mass | 579.50 |
| IUPAC Name | N,N-dimethyl-3-tris[(Z)-dec-4-enoxy]silylpropan-1-amine |
| SMILES | CCCCC/C=C\CCCO[Si](CCCN(C)C)(OCCC/C=C\CCCCC)OCCC/C=C\CCCCC |
| InChI | InChI=1S/C35H69NO3Si/c1-6-9-12-15-18-21-24-27-32-37-40(35-30-31-36(4)5,38-33-28-25-22-19-16-13-10-7-2)39-34-29-26-23-20-17-14-11-8-3/h18-23H,6-17,24-35H2,1-5H3/b21-18-,22-19-,23-20- |
| InChIKey | MEDOUGVDSMUXHB-ASSJVFBPSA-N |
| XLogP | 10.68 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.03 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|