C19H45N3O3Si — CID 140647406
N'-[3-(dimethylamino)propyl]-N,N-dimethyl-N'-(3-triethoxysilylpropyl)propane-1,3-diamine (PubChem CID 140647406) has the molecular formula C19H45N3O3Si and a molecular weight of 391.67 g/mol. Its IUPAC name is N'-[3-(dimethylamino)propyl]-N,N-dimethyl-N'-(3-triethoxysilylpropyl)propane-1,3-diamine.
| Compound Name | N'-[3-(dimethylamino)propyl]-N,N-dimethyl-N'-(3-triethoxysilylpropyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 140647406 |
| Molecular Formula | C19H45N3O3Si |
| Molecular Weight | 391.67 g/mol |
| Exact Mass | 391.32 |
| IUPAC Name | N'-[3-(dimethylamino)propyl]-N,N-dimethyl-N'-(3-triethoxysilylpropyl)propane-1,3-diamine |
| SMILES | CCO[Si](CCCN(CCCN(C)C)CCCN(C)C)(OCC)OCC |
| InChI | InChI=1S/C19H45N3O3Si/c1-8-23-26(24-9-2,25-10-3)19-13-18-22(16-11-14-20(4)5)17-12-15-21(6)7/h8-19H2,1-7H3 |
| InChIKey | BCASPCURGYOSDN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 37.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.67 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|